Attributes
UniProt ID
Protein Name
Prolyl endopeptidase
Ligand Name
N-BENZYLOXYCARBONYL-L-PROLYL-L-PROLINAL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ORZXYSPOAVJYRU-HOTGVXAUSA-N
SMILES
c1ccc(cc1)COC(=O)N2CCCC2C(=O)N3CCCC3C=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5UW6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5uw6A1e5uw6A2e5uw6B1e5uw6B2e5uw6C1e5uw6C2e5uw6D2e5uw6D3
ECOD domains from experimental PDB structures interacting with ligand DB03535
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6A1 | A:12-438 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6A2 | A:439-723 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6B1 | B:2-438 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6B2 | B:439-724 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6C1 | C:5-438 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6C2 | C:439-723 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6D2 | D:4-438 |
| R4P353 | DB03535 | ZPR | 5uw6 | e5uw6D3 | D:439-723 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwA2 | A:12-438 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwA3 | A:439-724 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwB2 | B:1-438 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwB3 | B:439-725 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwC2 | C:5-438 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwC3 | C:439-724 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwD2 | D:3-438 |
| R4P353 | DB03535 | ZPR | 5uzw | e5uzwD3 | D:439-724 |