Attributes
UniProt ID
Protein Name
Xylulose5phosphatefructose6phosphate phosphoketolase
Ligand Name
THIAMINE DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AYEKOFBPNLCAJY-UHFFFAOYSA-O
SMILES
Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8IO6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8io6A1e8io6A2e8io6A3e8io6B1e8io6B2e8io6B3e8io6C1e8io6C2e8io6C3e8io6D1e8io6D2e8io6D3e8io6E1e8io6E2e8io6E3e8io6F1e8io6F2e8io6F3e8io6G1e8io6G2e8io6G3e8io6H1e8io6H2e8io6H3
ECOD domains from experimental PDB structures interacting with ligand TPP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| S6CP45 | n/a | TPP | 8io6 | e8io6A2 | A:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6A3 | A:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6B1 | B:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6B3 | B:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6C2 | C:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6C3 | C:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6D1 | D:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6D2 | D:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6E1 | E:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6E2 | E:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6F1 | F:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6F2 | F:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6G2 | G:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6G3 | G:2-384 |
| S6CP45 | n/a | TPP | 8io6 | e8io6H1 | H:385-614 |
| S6CP45 | n/a | TPP | 8io6 | e8io6H3 | H:2-384 |
| S6CP45 | n/a | TPP | 8io7 | e8io7A2 | A:2-384 |
| S6CP45 | n/a | TPP | 8io7 | e8io7A3 | A:385-614 |
| S6CP45 | n/a | TPP | 8io7 | e8io7B2 | B:2-384 |
| S6CP45 | n/a | TPP | 8io7 | e8io7B3 | B:385-614 |