Attributes
UniProt ID
Protein Name
Gag polyprotein
Ligand Name
INOSITOL HEXAKISPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IMQLKJBTEOYOSI-GPIVLXJGSA-N
SMILES
C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7E1I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7e1iA1e7e1iB1e7e1iC1e7e1iD1e7e1iE1e7e1iF1e7e1iG1e7e1iH1e7e1iI1e7e1iJ1e7e1iK1e7e1iL1
ECOD domains from experimental PDB structures interacting with ligand DB14981
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iA1 | A:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iB1 | B:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iC1 | C:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iD1 | D:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iE1 | E:2-120 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iF1 | F:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iG1 | G:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iH1 | H:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iI1 | I:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iJ1 | J:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iK1 | K:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1i | e7e1iL1 | L:2-122 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jA1 | A:0-115 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jB1 | B:-1-107 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jC1 | C:-1-109 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jD1 | D:-1-108 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jE1 | E:3-110 |
| T2CJ20 | DB14981 | IHP | 7e1j | e7e1jF1 | F:2-112 |
| T2CJ20 | DB14981 | IHP | 7e1k | e7e1kA1 | A:1-121 |
| T2CJ20 | DB14981 | IHP | 7e1k | e7e1kB1 | B:2-122 |