Attributes
UniProt ID
Protein Name
Hemagglutinin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3WHE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3whe01e3whe02e3whe11e3whe12e3whe21e3whe22e3whe31e3whe32e3whe41e3whe42e3whe51e3whe52e3whe61e3whe62e3whe71e3whe72e3whe81e3whe82e3whe91e3whe92e3wheA1e3wheA2e3wheB1e3wheB2e3wheC1e3wheC2e3wheD1e3wheD2e3wheE1e3wheE2e3wheF1e3wheF2e3wheG1e3wheG2e3wheH1e3wheH2e3wheI1e3wheI2e3wheJ1e3wheJ2e3wheK1e3wheK2e3wheL1e3wheL2e3wheM1e3wheM2e3wheN1e3wheN2e3wheO1e3wheO2e3wheP1e3wheP2e3wheQ1e3wheQ2e3wheR1e3wheR2e3wheS1e3wheS2e3wheT1e3wheT2e3wheU1e3wheU2e3wheV1e3wheV2e3wheW1e3wheW2e3wheX1e3wheX2e3wheY1e3wheY2e3wheZ1e3wheZ2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| T2HNI1 | DB00141 | NAG | 3whe | e3wheA1 | A:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheA2 | A:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheB1 | B:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheB2 | B:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheC1 | C:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheC2 | C:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheD1 | D:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheD2 | D:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheE1 | E:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheE2 | E:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheF1 | F:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheF2 | F:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheG1 | G:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheG2 | G:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheH1 | H:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheH2 | H:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheI1 | I:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheI2 | I:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheJ1 | J:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheJ2 | J:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheK1 | K:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheK2 | K:9-330 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheL1 | L:330-501 |
| T2HNI1 | DB00141 | NAG | 3whe | e3wheL2 | L:9-330 |