Attributes
UniProt ID
Protein Name
Alcohol dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8H2A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8h2aA1e8h2aA2e8h2aB1e8h2aB2e8h2aC1e8h2aC2e8h2aD1e8h2aD2e8h2aE1e8h2aE2e8h2aF1e8h2aF2e8h2aG1e8h2aG2e8h2aH1e8h2aH2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aA1 | A:1-157,A:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aA2 | A:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aB1 | B:1-157,B:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aB2 | B:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aC1 | C:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aC2 | C:4-157,C:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aD1 | D:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aD2 | D:3-157,D:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aE1 | E:3-157,E:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aE2 | E:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aF1 | F:4-157,F:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aF2 | F:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aG1 | G:158-334 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aG2 | G:2-157,G:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aH1 | H:3-157,H:335-370 |
| T2KM87 | DB14128 | NAD | 8h2a | e8h2aH2 | H:158-334 |