Attributes
UniProt ID
Protein Name
deleted
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6EP2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ep2A1e6ep2B1e6ep2C1e6ep2D1e6ep2E1e6ep2F1e6ep2G1e6ep2H1e6ep2I1e6ep2J1e6ep2K1e6ep2L1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2A1 | A:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2B1 | B:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2C1 | C:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2D1 | D:5-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2E1 | E:5-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2F1 | F:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2G1 | G:5-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2H1 | H:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2I1 | I:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2J1 | J:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2K1 | K:4-207 |
| U6S0Y1 | DB16833 | ADP | 6ep2 | e6ep2L1 | L:5-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5A1 | A:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5B1 | B:16-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5C1 | C:5-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5D1 | D:6-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5E1 | E:10-207 |
| U6S0Y1 | DB16833 | ADP | 6ep5 | e6ep5F1 | F:5-207 |