Attributes
UniProt ID
Protein Name
Spike glycoprotein
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5W9H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5w9hA1e5w9hB1e5w9hC1e5w9hD1e5w9hE1e5w9hF1e5w9hG1e5w9hH1e5w9hI1e5w9hp1e5w9hp2e5w9hp3e5w9hq1e5w9hq2e5w9hq3e5w9hr1e5w9hr2e5w9hr3
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hA1 | A:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hD1 | D:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hG1 | G:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hp1 | p:18-356 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hp3 | p:591-743 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hq1 | q:18-356 |
| W5ZZF5 | DB00141 | NAG | 5w9h | e5w9hr1 | r:18-356 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iA1 | A:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iB1 | B:18-356 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iE1 | E:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iF1 | F:18-356 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iI1 | I:753-1223 |
| W5ZZF5 | DB00141 | NAG | 5w9i | e5w9iJ1 | J:18-356 |
| W5ZZF5 | DB00141 | NAG | 6pz8 | e6pz8A1 | A:753-1223 |
| W5ZZF5 | DB00141 | NAG | 6pz8 | e6pz8E1 | E:753-1223 |
| W5ZZF5 | DB00141 | NAG | 6pz8 | e6pz8I1 | I:753-1223 |