Attributes
UniProt ID
Protein Name
3'-5' exonuclease
Ligand Name
GUANOSINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RQFCJASXJCIDSX-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7MPP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7mppA1e7mppC1e7mppE1e7mppG1e7mppI1e7mppK1e7mppM1e7mppO1
ECOD domains from experimental PDB structures interacting with ligand DB01972
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppA1 | A:1-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppC1 | C:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppE1 | E:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppG1 | G:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppI1 | I:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppK1 | K:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppM1 | M:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpp | e7mppO1 | O:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqA1 | A:1-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqC1 | C:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqE1 | E:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqG1 | G:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqI1 | I:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqK1 | K:2-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqM1 | M:3-206 |
| X5MEI1 | DB01972 | 5GP | 7mpq | e7mpqO1 | O:3-206 |