PDB ligand accession: MQ8
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: LXKDFTDVRVLXFY-ACMRXAIVSA-N
SMILES: CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q93RD8_MQ8 | Q93RD8 | H subunit of | n/a | |
2 | A0A143BJ28_MQ8 | A0A143BJ28 | Photosynthetic reaction centre | n/a | |
3 | D2Z0P9_MQ8 | D2Z0P9 | Photosynthetic reaction center | n/a | |
4 | A0A143BHR2_MQ8 | A0A143BHR2 | Reaction center protein | n/a | |
5 | G1BIZ0_MQ8 | G1BIZ0 | Alpha subunit 2 | n/a | |
6 | D2Z0P3_MQ8 | D2Z0P3 | Reaction center protein | n/a | |
7 | A8ASG6_MQ8 | A8ASG6 | Reaction center protein | n/a | |
8 | G1BIY5_MQ8 | G1BIY5 | Alpha subunit 1 | n/a | |
9 | D2Z0P2_MQ8 | D2Z0P2 | LH1 alpha polypeptide | n/a | |
10 | A0A143BHS7_MQ8 | A0A143BHS7 | Antenna complex alpha/beta | n/a | |
11 | G1BIY6_MQ8 | G1BIY6 | Reaction center protein | n/a | |
12 | G1BIY7_MQ8 | G1BIY7 | Reaction center protein | n/a |