PDB ligand accession: U10
DrugBank: DB09270
PubChem:
ChEMBL:
InChI Key: ACTIUHUUMQJHFO-UPTCCGCDSA-N
SMILES: CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q3J1A5_U10 | Q3J1A5 | Reaction center protein | n/a | |
| 2 | A0A7Z6W8S0_U10 | A0A7Z6W8S0 | deleted | n/a | |
| 3 | P19057_U10 | P19057 | Reaction center protein | n/a | |
| 4 | A0A2S6NEP5_U10 | A0A2S6NEP5 | Reaction center protein | n/a | |
| 5 | A0A2S6NEL9_U10 | A0A2S6NEL9 | Light-harvesting protein | n/a | |
| 6 | Q950Z0_U10 | Q950Z0 | NADH dehydrogenase subunit | n/a | |
| 7 | P18946_U10 | P18946 | Cytochrome b (Complex | n/a | |
| 8 | P18930_U10 | P18930 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 9 | P03910_U10 | P03910 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 10 | A0A7Z6QV86_U10 | A0A7Z6QV86 | deleted | n/a | |
| 11 | A0A2T4JIL7_U10 | A0A2T4JIL7 | Antenna pigment protein | n/a | |
| 12 | Q2RQ24_U10 | Q2RQ24 | Antenna complex, alpha/beta | n/a | |
| 13 | C7DZL9_U10 | C7DZL9 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 14 | P24959_U10 | P24959 | Cytochrome b (Complex | n/a | |
| 15 | P0C0Y9_U10 | P0C0Y9 | Reaction center protein | n/a | |
| 16 | P42027_U10 | P42027 | NADH dehydrogenase [ubiquinone] | n/a | |
| 17 | A0A4Z7_U10 | A0A4Z7 | Reaction center protein | n/a | |
| 18 | A0A2S6NEG7_U10 | A0A2S6NEG7 | Reaction center protein | n/a | |
| 19 | A0A0N8VFH9_U10 | A0A0N8VFH9 | Reaction center protein | n/a | |
| 20 | P0C0Y8_U10 | P0C0Y8 | Reaction center protein | n/a | |
| 21 | A0A1S3U8J5_U10 | A0A1S3U8J5 | NADH dehydrogenase [ubiquinone] | n/a | |
| 22 | Q2RQ26_U10 | Q2RQ26 | Reaction center protein | n/a | |
| 23 | A0A069Q767_U10 | A0A069Q767 | Cytochrome b/c1 (Cytochrome | n/a | |
| 24 | A0A069Q0N5_U10 | A0A069Q0N5 | Ubiquinol-cytochrome c reductase | n/a | |
| 25 | A0A2T4JIN0_U10 | A0A2T4JIN0 | Reaction center protein | n/a | |
| 26 | Q3J1A6_U10 | Q3J1A6 | Reaction center protein | n/a | |
| 27 | Q3J1A4_U10 | Q3J1A4 | Light-harvesting protein B-875 | n/a | |
| 28 | A0A7Z6QV32_U10 | A0A7Z6QV32 | deleted | n/a | |
| 29 | A0A2S6NEK3_U10 | A0A2S6NEK3 | Light-harvesting protein | n/a | |
| 30 | P42026_U10 | P42026 | NADH dehydrogenase [ubiquinone] | n/a | |
| 31 | P0C0Y7_U10 | P0C0Y7 | Reaction center protein | n/a | |
| 32 | P10717_U10 | P10717 | Reaction center protein | n/a | |
| 33 | A0A7Z6QV46_U10 | A0A7Z6QV46 | deleted | n/a | |
| 34 | P02948_U10 | P02948 | Light-harvesting protein B-870 | n/a | |
| 35 | A0A7Z6QV72_U10 | A0A7Z6QV72 | deleted | n/a | |
| 36 | M1V1V5_U10 | M1V1V5 | Fructose dehydrogenase cytochrome | n/a | |
| 37 | A0A2T4JIR4_U10 | A0A2T4JIR4 | Antenna pigment protein | n/a | |
| 38 | A0A0Q0UNB5_U10 | A0A0Q0UNB5 | Reaction center protein | n/a | |
| 39 | Q2RWS4_U10 | Q2RWS4 | Photosynthetic reaction center, | n/a | |
| 40 | P03887_U10 | P03887 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 41 | P03892_U10 | P03892 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 42 | Q6N9L4_U10 | Q6N9L4 | Light-harvesting antenna LH1, | n/a | |
| 43 | Q3IY10_U10 | Q3IY10 | Cytochrome b | n/a | |
| 44 | P0C8L0_U10 | P0C8L0 | Cytochrome b (Complex | n/a | |
| 45 | Q2RQ25_U10 | Q2RQ25 | Reaction center protein | n/a | |
| 46 | A0A2S6MZS1_U10 | A0A2S6MZS1 | Photosynthetic reaction center | n/a | |
| 47 | A0A2T4JIS6_U10 | A0A2T4JIS6 | Reaction center protein | n/a | |
| 48 | Q3IY09_U10 | Q3IY09 | Ubiquinol-cytochrome c reductase | n/a | |
| 49 | Q09154_U10 | Q09154 | Cytochrome b-c1 complex | n/a | |
| 50 | P02954_U10 | P02954 | Reaction center protein | n/a | |
| 51 | Q3J170_U10 | Q3J170 | Reaction center protein | n/a | |
| 52 | P31040_U10 | P31040 | Succinate dehydrogenase [ubiquinone] | cofactor | |
| 53 | P11846_U10 | P11846 | Reaction center protein | n/a | |
| 54 | Q7JAS9_U10 | Q7JAS9 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 55 | P02953_U10 | P02953 | Reaction center protein | n/a | |
| 56 | P92558_U10 | P92558 | NADH-ubiquinone oxidoreductase chain | n/a | |
| 57 | A0A4Z9_U10 | A0A4Z9 | H subunit of | n/a | |
| 58 | P11847_U10 | P11847 | Reaction center protein | n/a | |
| 59 | Q5DW50_U10 | Q5DW50 | Aldehyde dehydrogenase (Cytochrome | n/a | |
| 60 | P05501_U10 | P05501 | Cytochrome b (Complex | n/a | |
| 61 | Q2JJF6_U10 | Q2JJF6 | Vitamin K epoxide | n/a | |
| 62 | O83005_U10 | O83005 | Reaction center protein | n/a | |
| 63 | A0A071LG61_U10 | A0A071LG61 | Cytochrome b | n/a |