PDB ligand accession: CRT
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P02953_CRT | P02953 | Reaction center protein | n/a | |
2 | Q2RQ24_CRT | Q2RQ24 | Antenna complex, alpha/beta | n/a | |
3 | A8ASG6_CRT | A8ASG6 | Reaction center protein | n/a | |
4 | Q6N9L5_CRT | Q6N9L5 | Light-harvesting antenna LH1, | n/a | |
5 | D2Z0P2_CRT | D2Z0P2 | LH1 alpha polypeptide | n/a | |
6 | A0A4Z7_CRT | A0A4Z7 | Reaction center protein | n/a | |
7 | Q6N9L4_CRT | Q6N9L4 | Light-harvesting antenna LH1, | n/a | |
8 | Q2RQ26_CRT | Q2RQ26 | Reaction center protein | n/a | |
9 | P02947_CRT | P02947 | Light-harvesting protein B-870 | n/a | |
10 | A0A143BHS7_CRT | A0A143BHS7 | Antenna complex alpha/beta | n/a | |
11 | D2Z0P1_CRT | D2Z0P1 | LH1 beta polypeptide | n/a | |
12 | D2Z0P3_CRT | D2Z0P3 | Reaction center protein | n/a | |
13 | Q2RQ23_CRT | Q2RQ23 | Light-harvesting protein B-870 | n/a |