PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q83XD0_BCL | Q83XD0 | Reaction center protein | n/a | |
2 | G1BIY6_BCL | G1BIY6 | Reaction center protein | n/a | |
3 | A0A2R4GUZ8_BCL | A0A2R4GUZ8 | Light-harvesting protein | n/a | |
4 | A0A2T4JIS6_BCL | A0A2T4JIS6 | Reaction center protein | n/a | |
5 | A0A330HGC2_BCL | A0A330HGC2 | deleted | n/a | |
6 | D2Z0P2_BCL | D2Z0P2 | LH1 alpha polypeptide | n/a | |
7 | A0A143BHR2_BCL | A0A143BHR2 | Reaction center protein | n/a | |
8 | A0A2R4GVX2_BCL | A0A2R4GVX2 | deleted | n/a | |
9 | Q3J1A3_BCL | Q3J1A3 | Light-harvesting protein B-875 | n/a | |
10 | Q8KAY0_BCL | Q8KAY0 | Photosystem P840 reaction | n/a | |
11 | Q3J144_BCL | Q3J144 | Light-harvesting protein B-800/850 | n/a | |
12 | D2Z0P3_BCL | D2Z0P3 | Reaction center protein | n/a | |
13 | A0A2T4JIN0_BCL | A0A2T4JIN0 | Reaction center protein | n/a | |
14 | D2Z0P1_BCL | D2Z0P1 | LH1 beta polypeptide | n/a | |
15 | P80484_BCL | P80484 | Peridinin-chlorophyll a-binding protein | n/a | |
16 | P0C0Y9_BCL | P0C0Y9 | Reaction center protein | n/a | |
17 | A0A2S6NEG7_BCL | A0A2S6NEG7 | Reaction center protein | n/a | |
18 | A0A7Z6QV86_BCL | A0A7Z6QV86 | deleted | n/a | |
19 | A0A2S6NEL9_BCL | A0A2S6NEL9 | Light-harvesting protein | n/a | |
20 | A0A2T4JIR4_BCL | A0A2T4JIR4 | Antenna pigment protein | n/a | |
21 | P06010_BCL | P06010 | Reaction center protein | n/a | |
22 | G1BIY7_BCL | G1BIY7 | Reaction center protein | n/a | |
23 | A0A2T4JIL7_BCL | A0A2T4JIL7 | Antenna pigment protein | n/a | |
24 | Q7M158_BCL | Q7M158 | Light-harvesting protein B800-820 | n/a | |
25 | A0A4Z7_BCL | A0A4Z7 | Reaction center protein | n/a | |
26 | P02953_BCL | P02953 | Reaction center protein | n/a | |
27 | Q6N9L4_BCL | Q6N9L4 | Light-harvesting antenna LH1, | n/a | |
28 | A0A7Z6QV72_BCL | A0A7Z6QV72 | deleted | n/a | |
29 | P35089_BCL | P35089 | Light-harvesting protein B-800/820 | n/a | |
30 | H8Z3R9_BCL | H8Z3R9 | Antenna complex alpha/beta | n/a | |
31 | P97253_BCL | P97253 | Light-harvesting protein B-800/850 | n/a | |
32 | A0A7Z6W8S0_BCL | A0A7Z6W8S0 | deleted | n/a | |
33 | A0A143BHS8_BCL | A0A143BHS8 | Light-harvesting protein B:885 | n/a | |
34 | A0A2R4GZC1_BCL | A0A2R4GZC1 | Light-harvesting protein | n/a | |
35 | A0A323UGK7_BCL | A0A323UGK7 | Light-harvesting protein | n/a | |
36 | A0A7Z6QV46_BCL | A0A7Z6QV46 | deleted | n/a | |
37 | P19057_BCL | P19057 | Reaction center protein | n/a | |
38 | O83005_BCL | O83005 | Reaction center protein | n/a | |
39 | Q7M119_BCL | Q7M119 | Light-harvesting protein B800-820 | n/a | |
40 | G1BIZ0_BCL | G1BIZ0 | Alpha subunit 2 | n/a | |
41 | P06009_BCL | P06009 | Reaction center protein | n/a | |
42 | P11847_BCL | P11847 | Reaction center protein | n/a | |
43 | P0A314_BCL | P0A314 | Bacteriochlorophyll c-binding protein | n/a | |
44 | Q46393_BCL | Q46393 | Bacteriochlorophyll a protein | n/a | |
45 | A0A0Q0UNB5_BCL | A0A0Q0UNB5 | Reaction center protein | n/a | |
46 | A0A2S6MZS1_BCL | A0A2S6MZS1 | Photosynthetic reaction center | n/a | |
47 | Q3J1A4_BCL | Q3J1A4 | Light-harvesting protein B-875 | n/a | |
48 | Q83XD2_BCL | Q83XD2 | Beta subunit of | n/a | |
49 | A0A7Z6QV32_BCL | A0A7Z6QV32 | deleted | n/a | |
50 | P95673_BCL | P95673 | Light-harvesting protein B-800/850 | n/a | |
51 | G1BIY9_BCL | G1BIY9 | Antenna complex alpha/beta | n/a | |
52 | Q7B300_BCL | Q7B300 | Antenna pigment protein | n/a | |
53 | Q3J1A6_BCL | Q3J1A6 | Reaction center protein | n/a | |
54 | Q3J145_BCL | Q3J145 | Light-harvesting protein B-800/850 | n/a | |
55 | W0E6A1_BCL | W0E6A1 | Uncharacterized protein | n/a | |
56 | W0E5B0_BCL | W0E5B0 | Light-harvesting protein B:800-850 | n/a | |
57 | H8Z3S4_BCL | H8Z3S4 | Antenna complex alpha/beta | n/a | |
58 | A0A143BHS7_BCL | A0A143BHS7 | Antenna complex alpha/beta | n/a | |
59 | P11846_BCL | P11846 | Reaction center protein | n/a | |
60 | A0A2R4GRA8_BCL | A0A2R4GRA8 | Light-harvesting protein | n/a | |
61 | A0A2S6NEK3_BCL | A0A2S6NEK3 | Light-harvesting protein | n/a | |
62 | P0C0X9_BCL | P0C0X9 | Light-harvesting protein B-875 | n/a | |
63 | Q3J1A5_BCL | Q3J1A5 | Reaction center protein | n/a | |
64 | A0A0N8VFH9_BCL | A0A0N8VFH9 | Reaction center protein | n/a | |
65 | Q6N9L5_BCL | Q6N9L5 | Light-harvesting antenna LH1, | n/a | |
66 | P26789_BCL | P26789 | Light-harvesting protein B-800/850 | n/a | |
67 | P26790_BCL | P26790 | Light-harvesting protein B-800/850 | n/a | |
68 | A0A2T4JIP3_BCL | A0A2T4JIP3 | PufX | n/a | |
69 | P02954_BCL | P02954 | Reaction center protein | n/a | |
70 | A0A2S6NEP5_BCL | A0A2S6NEP5 | Reaction center protein | n/a | |
71 | A0A2R4GW23_BCL | A0A2R4GW23 | deleted | n/a | |
72 | P13402_BCL | P13402 | Intrinsic membrane protein | n/a | |
73 | W8L932_BCL | W8L932 | Light-harvesting protein B:800-850 | n/a | |
74 | A0A2R4GUT4_BCL | A0A2R4GUT4 | deleted | n/a | |
75 | P0C0Y8_BCL | P0C0Y8 | Reaction center protein | n/a | |
76 | P35094_BCL | P35094 | Light-harvesting protein B-800/820 | n/a | |
77 | P02948_BCL | P02948 | Light-harvesting protein B-870 | n/a | |
78 | G1BIY4_BCL | G1BIY4 | Antenna complex alpha/beta | n/a | |
79 | G1BIY5_BCL | G1BIY5 | Alpha subunit 1 | n/a | |
80 | P02950_BCL | P02950 | Light-harvesting protein B-870 | n/a | |
81 | P11741_BCL | P11741 | Bacteriochlorophyll a protein | n/a | |
82 | A8ASG6_BCL | A8ASG6 | Reaction center protein | n/a | |
83 | D2Z0P9_BCL | D2Z0P9 | Photosynthetic reaction center | n/a | |
84 | A7NQE9_BCL | A7NQE9 | Antenna complex alpha/beta | n/a |